About 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine
6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine (PubChem CID 53320703) has the molecular formula C18H17Cl2N3
and a molecular weight of 346.26 g/mol. Its IUPAC name is 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine.
Molecular Properties
| Compound Name | 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine |
| PubChem CID | 53320703 |
| Molecular Formula | C18H17Cl2N3 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine |
| SMILES | Nc1nccc2cc(CNCCc3ccc(Cl)c(Cl)c3)ccc12 |
| InChI | InChI=1S/C18H17Cl2N3/c19-16-4-2-12(10-17(16)20)5-7-22-11-13-1-3-15-14(9-13)6-8-23-18(15)21/h1-4,6,8-10,22H,5,7,11H2,(H2,21,23) |
| InChIKey | BIJYCMAPFSDOCZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine?
The IUPAC name of 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine (CID 53320703) is 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine.
What is the SMILES notation for 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine?
The canonical SMILES for 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine is Nc1nccc2cc(CNCCc3ccc(Cl)c(Cl)c3)ccc12.
What is the InChIKey of 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine?
The InChIKey is BIJYCMAPFSDOCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2N3/c19-16-4-2-12(10-17(16)20)5-7-22-11-13-1-3-15-14(9-13)6-8-23-18(15)21/h1-4,6,8-10,22H,5,7,11H2,(H2,21,23).
What are the key properties of 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine?
6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine has a molecular weight of 346.26 g/mol, XLogP of 4.46, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-(3,4-dichlorophenyl)ethylamino]methyl]isoquinolin-1-amine is sourced from PubChem (CID 53320703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).