C13H9Cl4N5 — CID 5332075
2,4,5-trichloro-6-[(2E)-2-[(1-methylpyridin-1-ium-3-yl)methylidene]hydrazinyl]pyridine-3-carbonitrile chloride (PubChem CID 5332075) has the molecular formula C13H9Cl4N5 and a molecular weight of 377.06 g/mol. Its IUPAC name is 2,4,5-trichloro-6-[(2E)-2-[(1-methylpyridin-1-ium-3-yl)methylidene]hydrazinyl]pyridine-3-carbonitrile chloride.
| Compound Name | 2,4,5-trichloro-6-[(2E)-2-[(1-methylpyridin-1-ium-3-yl)methylidene]hydrazinyl]pyridine-3-carbonitrile chloride |
|---|---|
| PubChem CID | 5332075 |
| Molecular Formula | C13H9Cl4N5 |
| Molecular Weight | 377.06 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 2,4,5-trichloro-6-[(2E)-2-[(1-methylpyridin-1-ium-3-yl)methylidene]hydrazinyl]pyridine-3-carbonitrile chloride |
| SMILES | C[n+]1cccc(/C=N/Nc2nc(Cl)c(C#N)c(Cl)c2Cl)c1.[Cl-] |
| InChI | InChI=1S/C13H9Cl3N5.ClH/c1-21-4-2-3-8(7-21)6-18-20-13-11(15)10(14)9(5-17)12(16)19-13;/h2-4,6-7H,1H3,(H,19,20);1H/q+1;/p-1/b18-6+; |
| InChIKey | CEHFZDJOWOBVLC-TWFGXWKLSA-M |
| XLogP | 0.19 |
| TPSA | 64.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.06 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|