C45H60ClN7O4 — CID 53320752
2-N,6-N-bis[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentyl]pyridine-2,6-dicarboxamide;hydrochloride (PubChem CID 53320752) has the molecular formula C45H60ClN7O4 and a molecular weight of 798.47 g/mol. Its IUPAC name is 2-N,6-N-bis[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentyl]pyridine-2,6-dicarboxamide;hydrochloride.
| Compound Name | 2-N,6-N-bis[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentyl]pyridine-2,6-dicarboxamide;hydrochloride |
|---|---|
| PubChem CID | 53320752 |
| Molecular Formula | C45H60ClN7O4 |
| Molecular Weight | 798.47 g/mol |
| Exact Mass | 797.44 |
| IUPAC Name | 2-N,6-N-bis[4-[(2-tert-butyl-6-methoxyquinolin-8-yl)amino]pentyl]pyridine-2,6-dicarboxamide;hydrochloride |
| SMILES | COc1cc(NC(C)CCCNC(=O)c2cccc(C(=O)NCCCC(C)Nc3cc(OC)cc4ccc(C(C)(C)C)nc34)n2)c2nc(C(C)(C)C)ccc2c1.Cl |
| InChI | InChI=1S/C45H59N7O4.ClH/c1-28(48-36-26-32(55-9)24-30-18-20-38(44(3,4)5)51-40(30)36)14-12-22-46-42(53)34-16-11-17-35(50-34)43(54)47-23-13-15-29(2)49-37-27-33(56-10)25-31-19-21-39(45(6,7)8)52-41(31)37;/h11,16-21,24-29,48-49H,12-15,22-23H2,1-10H3,(H,46,53)(H,47,54);1H |
| InChIKey | JCFIVZMBDPYHGY-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.47 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|