About 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione
1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione (PubChem CID 53320860) has the molecular formula C12H10N3O2+
and a molecular weight of 228.23 g/mol. Its IUPAC name is 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione.
Molecular Properties
| Compound Name | 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione |
| PubChem CID | 53320860 |
| Molecular Formula | C12H10N3O2+ |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione |
| SMILES | Cn1n[n+](C)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C12H10N3O2/c1-14-9-10(15(2)13-14)12(17)8-6-4-3-5-7(8)11(9)16/h3-6H,1-2H3/q+1 |
| InChIKey | HSGDGHACQACHDB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione?
The IUPAC name of 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione (CID 53320860) is 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione.
What is the SMILES notation for 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione?
The canonical SMILES for 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione is Cn1n[n+](C)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione?
The InChIKey is HSGDGHACQACHDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N3O2/c1-14-9-10(15(2)13-14)12(17)8-6-4-3-5-7(8)11(9)16/h3-6H,1-2H3/q+1.
What are the key properties of 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione?
1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione has a molecular weight of 228.23 g/mol, XLogP of 0.02, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylbenzo[f]benzotriazol-3-ium-4,9-dione is sourced from PubChem (CID 53320860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).