C25H33N3O3 — CID 53320949
3-[4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazol-1-yl]benzoic acid (PubChem CID 53320949) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3-[4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazol-1-yl]benzoic acid.
| Compound Name | 3-[4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 53320949 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 3-[4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazol-1-yl]benzoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COCc1cn(-c2cccc(C(=O)O)c2)nn1 |
| InChI | InChI=1S/C25H33N3O3/c1-19(2)8-5-9-20(3)10-6-11-21(4)14-15-31-18-23-17-28(27-26-23)24-13-7-12-22(16-24)25(29)30/h7-8,10,12-14,16-17H,5-6,9,11,15,18H2,1-4H3,(H,29,30)/b20-10+,21-14+ |
| InChIKey | RZJDCOVPFCXEAE-SKVGTYKASA-N |
| XLogP | 5.90 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|