C26H33N3O2 — CID 53320971
(3R,4S)-6-(1H-indol-7-yl)-2,2,4,8-tetramethyl-5-[(E)-(2-methylpropan-2-yl)oxyiminomethyl]-3,4-dihydro-1H-quinolin-3-ol (PubChem CID 53320971) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (3R,4S)-6-(1H-indol-7-yl)-2,2,4,8-tetramethyl-5-[(E)-(2-methylpropan-2-yl)oxyiminomethyl]-3,4-dihydro-1H-quinolin-3-ol.
| Compound Name | (3R,4S)-6-(1H-indol-7-yl)-2,2,4,8-tetramethyl-5-[(E)-(2-methylpropan-2-yl)oxyiminomethyl]-3,4-dihydro-1H-quinolin-3-ol |
|---|---|
| PubChem CID | 53320971 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (3R,4S)-6-(1H-indol-7-yl)-2,2,4,8-tetramethyl-5-[(E)-(2-methylpropan-2-yl)oxyiminomethyl]-3,4-dihydro-1H-quinolin-3-ol |
| SMILES | Cc1cc(-c2cccc3cc[nH]c23)c(/C=N/OC(C)(C)C)c2c1NC(C)(C)[C@H](O)[C@H]2C |
| InChI | InChI=1S/C26H33N3O2/c1-15-13-19(18-10-8-9-17-11-12-27-23(17)18)20(14-28-31-25(3,4)5)21-16(2)24(30)26(6,7)29-22(15)21/h8-14,16,24,27,29-30H,1-7H3/b28-14+/t16-,24+/m0/s1 |
| InChIKey | KYVMBWDMSYIENK-HXVXYLRZSA-N |
| XLogP | 5.96 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|