C29H31N3O2 — CID 53320972
(3R,4S)-6-(1H-indol-7-yl)-2,2,4,8-tetramethyl-5-[(E)-phenylmethoxyiminomethyl]-3,4-dihydro-1H-quinolin-3-ol (PubChem CID 53320972) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is (3R,4S)-6-(1H-indol-7-yl)-2,2,4,8-tetramethyl-5-[(E)-phenylmethoxyiminomethyl]-3,4-dihydro-1H-quinolin-3-ol.
| Compound Name | (3R,4S)-6-(1H-indol-7-yl)-2,2,4,8-tetramethyl-5-[(E)-phenylmethoxyiminomethyl]-3,4-dihydro-1H-quinolin-3-ol |
|---|---|
| PubChem CID | 53320972 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | (3R,4S)-6-(1H-indol-7-yl)-2,2,4,8-tetramethyl-5-[(E)-phenylmethoxyiminomethyl]-3,4-dihydro-1H-quinolin-3-ol |
| SMILES | Cc1cc(-c2cccc3cc[nH]c23)c(/C=N/OCc2ccccc2)c2c1NC(C)(C)[C@H](O)[C@H]2C |
| InChI | InChI=1S/C29H31N3O2/c1-18-15-23(22-12-8-11-21-13-14-30-27(21)22)24(16-31-34-17-20-9-6-5-7-10-20)25-19(2)28(33)29(3,4)32-26(18)25/h5-16,19,28,30,32-33H,17H2,1-4H3/b31-16+/t19-,28+/m0/s1 |
| InChIKey | YENJQTUDPVMEAA-CJJDCIQDSA-N |
| XLogP | 6.36 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|