About (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate
(1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate (PubChem CID 53321085) has the molecular formula C23H30N2O2
and a molecular weight of 366.50 g/mol. Its IUPAC name is (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate.
Molecular Properties
| Compound Name | (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate |
| PubChem CID | 53321085 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate |
| SMILES | CCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O2/c1-2-3-9-16-25-17-14-20(15-18-25)27-23(26)24-22-13-8-7-12-21(22)19-10-5-4-6-11-19/h4-8,10-13,20H,2-3,9,14-18H2,1H3,(H,24,26) |
| InChIKey | OGGMZCFUDVJLKS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate?
The IUPAC name of (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate (CID 53321085) is (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate.
What is the SMILES notation for (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate?
The canonical SMILES for (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate is CCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1.
What is the InChIKey of (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate?
The InChIKey is OGGMZCFUDVJLKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O2/c1-2-3-9-16-25-17-14-20(15-18-25)27-23(26)24-22-13-8-7-12-21(22)19-10-5-4-6-11-19/h4-8,10-13,20H,2-3,9,14-18H2,1H3,(H,24,26).
What are the key properties of (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate?
(1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate has a molecular weight of 366.50 g/mol, XLogP of 5.56, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-pentylpiperidin-4-yl) N-(2-phenylphenyl)carbamate is sourced from PubChem (CID 53321085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).