C36H49F9O4 — CID 53321149
11-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)undecanoic acid (PubChem CID 53321149) has the molecular formula C36H49F9O4 and a molecular weight of 716.77 g/mol. Its IUPAC name is 11-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)undecanoic acid.
| Compound Name | 11-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)undecanoic acid |
|---|---|
| PubChem CID | 53321149 |
| Molecular Formula | C36H49F9O4 |
| Molecular Weight | 716.77 g/mol |
| Exact Mass | 716.35 |
| IUPAC Name | 11-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)undecanoic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4C[C@@H](CCCCCCCCCC(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O)[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C36H49F9O4/c1-32-19-17-27-26-14-13-25(46)21-24(26)20-23(30(27)28(32)15-16-29(32)47)11-8-6-4-2-3-5-7-10-22(31(48)49)12-9-18-33(37,38)34(39,40)35(41,42)36(43,44)45/h13-14,21-23,27-30,46-47H,2-12,15-20H2,1H3,(H,48,49)/t22?,23-,27-,28+,29+,30-,32+/m1/s1 |
| InChIKey | BFFBNQBPMDMILI-HWTKBXAZSA-N |
| XLogP | 10.69 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.77 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|