C30H46O5 — CID 53321163
(1S,4S,5R,8R,14R,15R,17S,18S,19R)-17-hydroxy-4,5,9,9,14,21,21-heptamethyl-10,25-dioxahexacyclo[16.5.2.01,19.04,18.05,15.08,14]pentacosane-11,24-dione (PubChem CID 53321163) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is (1S,4S,5R,8R,14R,15R,17S,18S,19R)-17-hydroxy-4,5,9,9,14,21,21-heptamethyl-10,25-dioxahexacyclo[16.5.2.01,19.04,18.05,15.08,14]pentacosane-11,24-dione.
| Compound Name | (1S,4S,5R,8R,14R,15R,17S,18S,19R)-17-hydroxy-4,5,9,9,14,21,21-heptamethyl-10,25-dioxahexacyclo[16.5.2.01,19.04,18.05,15.08,14]pentacosane-11,24-dione |
|---|---|
| PubChem CID | 53321163 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (1S,4S,5R,8R,14R,15R,17S,18S,19R)-17-hydroxy-4,5,9,9,14,21,21-heptamethyl-10,25-dioxahexacyclo[16.5.2.01,19.04,18.05,15.08,14]pentacosane-11,24-dione |
| SMILES | CC1(C)CC[C@@]23CC[C@]4(C)[C@@](OC2=O)([C@@H]3C1)[C@@H](O)C[C@@H]1[C@@]2(C)CCC(=O)OC(C)(C)[C@@H]2CC[C@]14C |
| InChI | InChI=1S/C30H46O5/c1-24(2)12-14-29-15-13-28(7)27(6)11-8-18-25(3,4)34-22(32)9-10-26(18,5)19(27)16-21(31)30(28,20(29)17-24)35-23(29)33/h18-21,31H,8-17H2,1-7H3/t18-,19+,20+,21-,26-,27+,28-,29-,30+/m0/s1 |
| InChIKey | GFYBHONKGXFOHC-WVFFDDOJSA-N |
| XLogP | 5.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |