C15H21N5O2S — CID 53321200
(2R,3R,4S)-2-[6-amino-8-[(E)-hex-1-enyl]purin-9-yl]thiolane-3,4-diol (PubChem CID 53321200) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is (2R,3R,4S)-2-[6-amino-8-[(E)-hex-1-enyl]purin-9-yl]thiolane-3,4-diol.
| Compound Name | (2R,3R,4S)-2-[6-amino-8-[(E)-hex-1-enyl]purin-9-yl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 53321200 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (2R,3R,4S)-2-[6-amino-8-[(E)-hex-1-enyl]purin-9-yl]thiolane-3,4-diol |
| SMILES | CCCC/C=C/c1nc2c(N)ncnc2n1[C@@H]1SC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H21N5O2S/c1-2-3-4-5-6-10-19-11-13(16)17-8-18-14(11)20(10)15-12(22)9(21)7-23-15/h5-6,8-9,12,15,21-22H,2-4,7H2,1H3,(H2,16,17,18)/b6-5+/t9-,12-,15-/m1/s1 |
| InChIKey | RHUKZCSJKNZBOF-GXDOZBQNSA-N |
| XLogP | 1.58 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|