About 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide
2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide (PubChem CID 53321278) has the molecular formula C28H34ClN3O2
and a molecular weight of 480.05 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide.
Molecular Properties
| Compound Name | 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide |
| PubChem CID | 53321278 |
| Molecular Formula | C28H34ClN3O2 |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide |
| SMILES | COc1ccc2nc(-c3ccc(Cl)cc3)n(C(C(=O)NC3CCCCC3)C3CCCCC3)c2c1 |
| InChI | InChI=1S/C28H34ClN3O2/c1-34-23-16-17-24-25(18-23)32(27(31-24)20-12-14-21(29)15-13-20)26(19-8-4-2-5-9-19)28(33)30-22-10-6-3-7-11-22/h12-19,22,26H,2-11H2,1H3,(H,30,33) |
| InChIKey | FICSTGBZKOGDOI-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide?
The IUPAC name of 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide (CID 53321278) is 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide.
What is the SMILES notation for 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide?
The canonical SMILES for 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide is COc1ccc2nc(-c3ccc(Cl)cc3)n(C(C(=O)NC3CCCCC3)C3CCCCC3)c2c1.
What is the InChIKey of 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide?
The InChIKey is FICSTGBZKOGDOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34ClN3O2/c1-34-23-16-17-24-25(18-23)32(27(31-24)20-12-14-21(29)15-13-20)26(19-8-4-2-5-9-19)28(33)30-22-10-6-3-7-11-22/h12-19,22,26H,2-11H2,1H3,(H,30,33).
What are the key properties of 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide?
2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide has a molecular weight of 480.05 g/mol, XLogP of 6.94, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chlorophenyl)-6-methoxybenzimidazol-1-yl]-N,2-dicyclohexylacetamide is sourced from PubChem (CID 53321278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).