C21H21F2NO2 — CID 53321338
[1-[(3,4-difluorophenyl)methyl]-2,2,4-trimethylquinolin-6-yl] acetate (PubChem CID 53321338) has the molecular formula C21H21F2NO2 and a molecular weight of 357.40 g/mol. Its IUPAC name is [1-[(3,4-difluorophenyl)methyl]-2,2,4-trimethylquinolin-6-yl] acetate.
| Compound Name | [1-[(3,4-difluorophenyl)methyl]-2,2,4-trimethylquinolin-6-yl] acetate |
|---|---|
| PubChem CID | 53321338 |
| Molecular Formula | C21H21F2NO2 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [1-[(3,4-difluorophenyl)methyl]-2,2,4-trimethylquinolin-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)C(C)=CC(C)(C)N2Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H21F2NO2/c1-13-11-21(3,4)24(12-15-5-7-18(22)19(23)9-15)20-8-6-16(10-17(13)20)26-14(2)25/h5-11H,12H2,1-4H3 |
| InChIKey | ILLXQAXNQYEZEI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|