C11H8N4OS2 — CID 53321415
9-azido-3,4-dihydro-2H-[1]benzothiolo[2,3-f][1,4]thiazepin-5-one (PubChem CID 53321415) has the molecular formula C11H8N4OS2 and a molecular weight of 276.35 g/mol. Its IUPAC name is 9-azido-3,4-dihydro-2H-[1]benzothiolo[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 9-azido-3,4-dihydro-2H-[1]benzothiolo[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 53321415 |
| Molecular Formula | C11H8N4OS2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 9-azido-3,4-dihydro-2H-[1]benzothiolo[2,3-f][1,4]thiazepin-5-one |
| SMILES | [N-]=[N+]=Nc1ccc2sc3c(c2c1)SCCNC3=O |
| InChI | InChI=1S/C11H8N4OS2/c12-15-14-6-1-2-8-7(5-6)9-10(18-8)11(16)13-3-4-17-9/h1-2,5H,3-4H2,(H,13,16) |
| InChIKey | JXJQWEXEIMCLAU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|