C22H26FN3O6 — CID 53321468
[(1R,2R,9S,17S)-5-hydroxy-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] 4-fluoro-3-nitrobenzoate (PubChem CID 53321468) has the molecular formula C22H26FN3O6 and a molecular weight of 447.46 g/mol. Its IUPAC name is [(1R,2R,9S,17S)-5-hydroxy-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] 4-fluoro-3-nitrobenzoate.
| Compound Name | [(1R,2R,9S,17S)-5-hydroxy-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] 4-fluoro-3-nitrobenzoate |
|---|---|
| PubChem CID | 53321468 |
| Molecular Formula | C22H26FN3O6 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [(1R,2R,9S,17S)-5-hydroxy-6-oxo-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-4-yl] 4-fluoro-3-nitrobenzoate |
| SMILES | O=C(OC1C[C@@H]2[C@H]3CCCN4CCC[C@@H](CN2C(=O)C1O)[C@@H]34)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H26FN3O6/c23-15-6-5-12(9-17(15)26(30)31)22(29)32-18-10-16-14-4-2-8-24-7-1-3-13(19(14)24)11-25(16)21(28)20(18)27/h5-6,9,13-14,16,18-20,27H,1-4,7-8,10-11H2/t13-,14+,16+,18?,19-,20?/m0/s1 |
| InChIKey | RZJQSNMDLPXBRA-CQWTXSJPSA-N |
| XLogP | 1.73 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|