C21H37NO — CID 53321666
(9Z,12Z,15Z)-N-propan-2-yloctadeca-9,12,15-trienamide (PubChem CID 53321666) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is (9Z,12Z,15Z)-N-propan-2-yloctadeca-9,12,15-trienamide.
| Compound Name | (9Z,12Z,15Z)-N-propan-2-yloctadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 53321666 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | (9Z,12Z,15Z)-N-propan-2-yloctadeca-9,12,15-trienamide |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NC(C)C |
| InChI | InChI=1S/C21H37NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)22-20(2)3/h5-6,8-9,11-12,20H,4,7,10,13-19H2,1-3H3,(H,22,23)/b6-5-,9-8-,12-11- |
| InChIKey | JLATWNWMHRJDIY-AGRJPVHOSA-N |
| XLogP | 6.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|