About 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid
2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid (PubChem CID 53321679) has the molecular formula C23H23F2N3O3
and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid |
| PubChem CID | 53321679 |
| Molecular Formula | C23H23F2N3O3 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid |
| SMILES | COc1nc(NCC(F)(F)c2ccccc2)cc(-c2cccc(C(C)(C)C(=O)O)c2)n1 |
| InChI | InChI=1S/C23H23F2N3O3/c1-22(2,20(29)30)17-11-7-8-15(12-17)18-13-19(28-21(27-18)31-3)26-14-23(24,25)16-9-5-4-6-10-16/h4-13H,14H2,1-3H3,(H,29,30)(H,26,27,28) |
| InChIKey | MUJSAJMEUKIZNS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid?
The IUPAC name of 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid (CID 53321679) is 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid.
What is the SMILES notation for 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid?
The canonical SMILES for 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid is COc1nc(NCC(F)(F)c2ccccc2)cc(-c2cccc(C(C)(C)C(=O)O)c2)n1.
What is the InChIKey of 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid?
The InChIKey is MUJSAJMEUKIZNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23F2N3O3/c1-22(2,20(29)30)17-11-7-8-15(12-17)18-13-19(28-21(27-18)31-3)26-14-23(24,25)16-9-5-4-6-10-16/h4-13H,14H2,1-3H3,(H,29,30)(H,26,27,28).
What are the key properties of 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid?
2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid has a molecular weight of 427.45 g/mol, XLogP of 4.72, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[6-[(2,2-difluoro-2-phenylethyl)amino]-2-methoxypyrimidin-4-yl]phenyl]-2-methylpropanoic acid is sourced from PubChem (CID 53321679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).