About [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea
[(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea (PubChem CID 5332169) has the molecular formula C15H27N3O
and a molecular weight of 265.40 g/mol. Its IUPAC name is [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea.
Molecular Properties
| Compound Name | [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea |
| PubChem CID | 5332169 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea |
| SMILES | C/C(CCCC1C2CCC(C2)C1(C)C)=N/NC(N)=O |
| InChI | InChI=1S/C15H27N3O/c1-10(17-18-14(16)19)5-4-6-13-11-7-8-12(9-11)15(13,2)3/h11-13H,4-9H2,1-3H3,(H3,16,18,19)/b17-10- |
| InChIKey | YALFBPKIPIVCOZ-YVLHZVERSA-N |
| XLogP | 3.27 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea?
The IUPAC name of [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea (CID 5332169) is [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea.
What is the SMILES notation for [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea?
The canonical SMILES for [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea is C/C(CCCC1C2CCC(C2)C1(C)C)=N/NC(N)=O.
What is the InChIKey of [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea?
The InChIKey is YALFBPKIPIVCOZ-YVLHZVERSA-N. The full InChI is InChI=1S/C15H27N3O/c1-10(17-18-14(16)19)5-4-6-13-11-7-8-12(9-11)15(13,2)3/h11-13H,4-9H2,1-3H3,(H3,16,18,19)/b17-10-.
What are the key properties of [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea?
[(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea has a molecular weight of 265.40 g/mol, XLogP of 3.27, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentan-2-ylideneamino]urea is sourced from PubChem (CID 5332169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).