C26H42O3 — CID 53321751
trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,6R)-6-hydroxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 53321751) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,6R)-6-hydroxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,6R)-6-hydroxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 53321751 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R,6R)-6-hydroxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)CC(=C/C=C2\CCC[C@]3(C)[C@@H]([C@H](C)CCC[C@@H](C)O)CC[C@@H]23)C[C@H]1O |
| InChI | InChI=1S/C26H42O3/c1-17(7-5-8-18(2)27)22-12-13-23-21(9-6-14-26(22,23)4)11-10-20-15-24(28)19(3)25(29)16-20/h10-11,17-18,22-25,27-29H,3,5-9,12-16H2,1-2,4H3/b21-11+/t17-,18-,22-,23+,24-,25-,26-/m1/s1 |
| InChIKey | SWWBPPHPGINSED-JWHSEANYSA-N |
| XLogP | 5.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|