C23H32ClN3O — CID 53321773
3-(4-methoxyphenyl)-9-(2-phenylethyl)-3,9-diaza-6-azoniaspiro[5.5]undecane chloride (PubChem CID 53321773) has the molecular formula C23H32ClN3O and a molecular weight of 401.98 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-9-(2-phenylethyl)-3,9-diaza-6-azoniaspiro[5.5]undecane chloride.
| Compound Name | 3-(4-methoxyphenyl)-9-(2-phenylethyl)-3,9-diaza-6-azoniaspiro[5.5]undecane chloride |
|---|---|
| PubChem CID | 53321773 |
| Molecular Formula | C23H32ClN3O |
| Molecular Weight | 401.98 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 3-(4-methoxyphenyl)-9-(2-phenylethyl)-3,9-diaza-6-azoniaspiro[5.5]undecane chloride |
| SMILES | COc1ccc(N2CC[N+]3(CCN(CCc4ccccc4)CC3)CC2)cc1.[Cl-] |
| InChI | InChI=1S/C23H32N3O.ClH/c1-27-23-9-7-22(8-10-23)25-15-19-26(20-16-25)17-13-24(14-18-26)12-11-21-5-3-2-4-6-21;/h2-10H,11-20H2,1H3;1H/q+1;/p-1 |
| InChIKey | RSYHBUJSXMIXBQ-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.98 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|