C25H25NO4S — CID 53321819
(3R,4S)-4-(4-methoxyphenyl)-3-phenyl-1-(3,4,5-trimethoxyphenyl)azetidine-2-thione (PubChem CID 53321819) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is (3R,4S)-4-(4-methoxyphenyl)-3-phenyl-1-(3,4,5-trimethoxyphenyl)azetidine-2-thione.
| Compound Name | (3R,4S)-4-(4-methoxyphenyl)-3-phenyl-1-(3,4,5-trimethoxyphenyl)azetidine-2-thione |
|---|---|
| PubChem CID | 53321819 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (3R,4S)-4-(4-methoxyphenyl)-3-phenyl-1-(3,4,5-trimethoxyphenyl)azetidine-2-thione |
| SMILES | COc1ccc([C@@H]2[C@@H](c3ccccc3)C(=S)N2c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H25NO4S/c1-27-19-12-10-17(11-13-19)23-22(16-8-6-5-7-9-16)25(31)26(23)18-14-20(28-2)24(30-4)21(15-18)29-3/h5-15,22-23H,1-4H3/t22-,23-/m1/s1 |
| InChIKey | SSPMNBWELACZTI-DHIUTWEWSA-N |
| XLogP | 5.39 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|