C22H17N3OS — CID 53321844
(NZ)-N-[5-[(2-phenylthieno[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 53321844) has the molecular formula C22H17N3OS and a molecular weight of 371.47 g/mol. Its IUPAC name is (NZ)-N-[5-[(2-phenylthieno[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[5-[(2-phenylthieno[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 53321844 |
| Molecular Formula | C22H17N3OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (NZ)-N-[5-[(2-phenylthieno[2,3-c]pyridin-3-yl)amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | O/N=C1/CCc2cc(Nc3c(-c4ccccc4)sc4cnccc34)ccc21 |
| InChI | InChI=1S/C22H17N3OS/c26-25-19-9-6-15-12-16(7-8-17(15)19)24-21-18-10-11-23-13-20(18)27-22(21)14-4-2-1-3-5-14/h1-5,7-8,10-13,24,26H,6,9H2/b25-19- |
| InChIKey | UBWMJAQWDSWJJT-PLRJNAJWSA-N |
| XLogP | 5.83 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|