About 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate
5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate (PubChem CID 53321848) has the molecular formula C18H15N3O4Se
and a molecular weight of 416.30 g/mol. Its IUPAC name is 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate.
Molecular Properties
| Compound Name | 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate |
| PubChem CID | 53321848 |
| Molecular Formula | C18H15N3O4Se |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate |
| SMILES | N#C[Se]CCCCCN1C(=O)c2cccc3cc([N+](=O)[O-])cc(c23)C1=O |
| InChI | InChI=1S/C18H15N3O4Se/c19-11-26-8-3-1-2-7-20-17(22)14-6-4-5-12-9-13(21(24)25)10-15(16(12)14)18(20)23/h4-6,9-10H,1-3,7-8H2 |
| InChIKey | ZTCYABBFFUOFJT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate?
The IUPAC name of 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate (CID 53321848) is 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate.
What is the SMILES notation for 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate?
The canonical SMILES for 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate is N#C[Se]CCCCCN1C(=O)c2cccc3cc([N+](=O)[O-])cc(c23)C1=O.
What is the InChIKey of 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate?
The InChIKey is ZTCYABBFFUOFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O4Se/c19-11-26-8-3-1-2-7-20-17(22)14-6-4-5-12-9-13(21(24)25)10-15(16(12)14)18(20)23/h4-6,9-10H,1-3,7-8H2.
What are the key properties of 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate?
5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate has a molecular weight of 416.30 g/mol, XLogP of 3.12, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)pentyl selenocyanate is sourced from PubChem (CID 53321848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).