About N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide
N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide (PubChem CID 53321866) has the molecular formula C19H29N3O4
and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide.
Molecular Properties
| Compound Name | N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide |
| PubChem CID | 53321866 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)[C@@H](NC(=O)Nc1ccccc1)C(C)C |
| InChI | InChI=1S/C19H29N3O4/c1-4-5-9-15(12-22(26)13-23)18(24)17(14(2)3)21-19(25)20-16-10-7-6-8-11-16/h6-8,10-11,13-15,17,26H,4-5,9,12H2,1-3H3,(H2,20,21,25)/t15-,17+/m1/s1 |
| InChIKey | PDQMNJYIIDOUMK-WBVHZDCISA-N |
| XLogP | 3.06 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide?
The IUPAC name of N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide (CID 53321866) is N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide.
What is the SMILES notation for N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide?
The canonical SMILES for N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide is CCCC[C@H](CN(O)C=O)C(=O)[C@@H](NC(=O)Nc1ccccc1)C(C)C.
What is the InChIKey of N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide?
The InChIKey is PDQMNJYIIDOUMK-WBVHZDCISA-N. The full InChI is InChI=1S/C19H29N3O4/c1-4-5-9-15(12-22(26)13-23)18(24)17(14(2)3)21-19(25)20-16-10-7-6-8-11-16/h6-8,10-11,13-15,17,26H,4-5,9,12H2,1-3H3,(H2,20,21,25)/t15-,17+/m1/s1.
What are the key properties of N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide?
N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide has a molecular weight of 363.46 g/mol, XLogP of 3.06, 11 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,4S)-2-butyl-5-methyl-3-oxo-4-(phenylcarbamoylamino)hexyl]-N-hydroxyformamide is sourced from PubChem (CID 53321866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).