About methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate
methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate (PubChem CID 53321897) has the molecular formula C24H29NO3
and a molecular weight of 379.50 g/mol. Its IUPAC name is methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate.
Molecular Properties
| Compound Name | methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate |
| PubChem CID | 53321897 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)c1ccc2c(c1)cc(-c1cc(C)cc(C)c1)n2CC(C)O |
| InChI | InChI=1S/C24H29NO3/c1-15-9-16(2)11-18(10-15)22-13-19-12-20(24(4,5)23(27)28-6)7-8-21(19)25(22)14-17(3)26/h7-13,17,26H,14H2,1-6H3 |
| InChIKey | MOZIKIPMNMVIHR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate?
The IUPAC name of methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate (CID 53321897) is methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate.
What is the SMILES notation for methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate?
The canonical SMILES for methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate is COC(=O)C(C)(C)c1ccc2c(c1)cc(-c1cc(C)cc(C)c1)n2CC(C)O.
What is the InChIKey of methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate?
The InChIKey is MOZIKIPMNMVIHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO3/c1-15-9-16(2)11-18(10-15)22-13-19-12-20(24(4,5)23(27)28-6)7-8-21(19)25(22)14-17(3)26/h7-13,17,26H,14H2,1-6H3.
What are the key properties of methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate?
methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate has a molecular weight of 379.50 g/mol, XLogP of 4.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(3,5-dimethylphenyl)-1-(2-hydroxypropyl)indol-5-yl]-2-methylpropanoate is sourced from PubChem (CID 53321897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).