About ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate
ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate (PubChem CID 53321944) has the molecular formula C23H44O4
and a molecular weight of 384.60 g/mol. Its IUPAC name is ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate.
Molecular Properties
| Compound Name | ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate |
| PubChem CID | 53321944 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate |
| SMILES | CCCCCCCCC1OC(C)(C)OC1CCCCCCCC(=O)OCC |
| InChI | InChI=1S/C23H44O4/c1-5-7-8-9-11-14-17-20-21(27-23(3,4)26-20)18-15-12-10-13-16-19-22(24)25-6-2/h20-21H,5-19H2,1-4H3 |
| InChIKey | PIJCEZOSZITTQT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate?
The IUPAC name of ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate (CID 53321944) is ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate.
What is the SMILES notation for ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate?
The canonical SMILES for ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate is CCCCCCCCC1OC(C)(C)OC1CCCCCCCC(=O)OCC.
What is the InChIKey of ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate?
The InChIKey is PIJCEZOSZITTQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H44O4/c1-5-7-8-9-11-14-17-20-21(27-23(3,4)26-20)18-15-12-10-13-16-19-22(24)25-6-2/h20-21H,5-19H2,1-4H3.
What are the key properties of ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate?
ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate has a molecular weight of 384.60 g/mol, XLogP of 6.55, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-(2,2-dimethyl-5-octyl-1,3-dioxolan-4-yl)octanoate is sourced from PubChem (CID 53321944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).