About [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid
[5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid (PubChem CID 53321970) has the molecular formula C11H14NO4PS
and a molecular weight of 287.28 g/mol. Its IUPAC name is [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid.
Molecular Properties
| Compound Name | [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid |
| PubChem CID | 53321970 |
| Molecular Formula | C11H14NO4PS |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid |
| SMILES | CC(C)Cc1scnc1-c1ccc(P(=O)(O)O)o1 |
| InChI | InChI=1S/C11H14NO4PS/c1-7(2)5-9-11(12-6-18-9)8-3-4-10(16-8)17(13,14)15/h3-4,6-7H,5H2,1-2H3,(H2,13,14,15) |
| InChIKey | CZBFAIHTJQQUJB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid?
The IUPAC name of [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid (CID 53321970) is [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid.
What is the SMILES notation for [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid?
The canonical SMILES for [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid is CC(C)Cc1scnc1-c1ccc(P(=O)(O)O)o1.
What is the InChIKey of [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid?
The InChIKey is CZBFAIHTJQQUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NO4PS/c1-7(2)5-9-11(12-6-18-9)8-3-4-10(16-8)17(13,14)15/h3-4,6-7H,5H2,1-2H3,(H2,13,14,15).
What are the key properties of [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid?
[5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid has a molecular weight of 287.28 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[5-(2-methylpropyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid is sourced from PubChem (CID 53321970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).