About cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone
cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone (PubChem CID 53321972) has the molecular formula C24H20Cl2O3
and a molecular weight of 427.33 g/mol. Its IUPAC name is cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone |
| PubChem CID | 53321972 |
| Molecular Formula | C24H20Cl2O3 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone |
| SMILES | O=C(c1ccc(OCc2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)cc1)C1CC1 |
| InChI | InChI=1S/C24H20Cl2O3/c25-22-12-3-17(13-23(22)26)15-29-20-8-1-16(2-9-20)14-28-21-10-6-19(7-11-21)24(27)18-4-5-18/h1-3,6-13,18H,4-5,14-15H2 |
| InChIKey | XFHJCIITKHDRKM-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone?
The IUPAC name of cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone (CID 53321972) is cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone.
What is the SMILES notation for cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone?
The canonical SMILES for cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone is O=C(c1ccc(OCc2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)cc1)C1CC1.
What is the InChIKey of cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone?
The InChIKey is XFHJCIITKHDRKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20Cl2O3/c25-22-12-3-17(13-23(22)26)15-29-20-8-1-16(2-9-20)14-28-21-10-6-19(7-11-21)24(27)18-4-5-18/h1-3,6-13,18H,4-5,14-15H2.
What are the key properties of cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone?
cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone has a molecular weight of 427.33 g/mol, XLogP of 6.74, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[4-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methoxy]phenyl]methanone is sourced from PubChem (CID 53321972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).