C37H43N7O4 — CID 53322052
2-N,6-N-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]pyridine-2,6-dicarboxamide (PubChem CID 53322052) has the molecular formula C37H43N7O4 and a molecular weight of 649.80 g/mol. Its IUPAC name is 2-N,6-N-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 53322052 |
| Molecular Formula | C37H43N7O4 |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.34 |
| IUPAC Name | 2-N,6-N-bis[4-[(6-methoxyquinolin-8-yl)amino]pentyl]pyridine-2,6-dicarboxamide |
| SMILES | COc1cc(NC(C)CCCNC(=O)c2cccc(C(=O)NCCCC(C)Nc3cc(OC)cc4cccnc34)n2)c2ncccc2c1 |
| InChI | InChI=1S/C37H43N7O4/c1-24(42-32-22-28(47-3)20-26-12-8-16-38-34(26)32)10-6-18-40-36(45)30-14-5-15-31(44-30)37(46)41-19-7-11-25(2)43-33-23-29(48-4)21-27-13-9-17-39-35(27)33/h5,8-9,12-17,20-25,42-43H,6-7,10-11,18-19H2,1-4H3,(H,40,45)(H,41,46) |
| InChIKey | DWWDQCKBMQERBB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|