C27H34O4 — CID 53322093
benzyl (1R,4S,5R,9S,10S,13S)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 53322093) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is benzyl (1R,4S,5R,9S,10S,13S)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | benzyl (1R,4S,5R,9S,10S,13S)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 53322093 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | benzyl (1R,4S,5R,9S,10S,13S)-13-hydroxy-5,9-dimethyl-14-methylidene-15-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | C=C1C(=O)[C@@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)OCc4ccccc4)[C@@H]2CC[C@]1(O)C3 |
| InChI | InChI=1S/C27H34O4/c1-18-22(28)26-14-10-20-24(2,21(26)11-15-27(18,30)17-26)12-7-13-25(20,3)23(29)31-16-19-8-5-4-6-9-19/h4-6,8-9,20-21,30H,1,7,10-17H2,2-3H3/t20-,21-,24+,25+,26+,27-/m0/s1 |
| InChIKey | QHSRYLJFKVVACY-BMUFBPOZSA-N |
| XLogP | 4.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|