C15H14F3N3O3S — CID 53322139
ethyl (4S,5R,6S)-6-(3-cyanophenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate (PubChem CID 53322139) has the molecular formula C15H14F3N3O3S and a molecular weight of 373.36 g/mol. Its IUPAC name is ethyl (4S,5R,6S)-6-(3-cyanophenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl (4S,5R,6S)-6-(3-cyanophenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 53322139 |
| Molecular Formula | C15H14F3N3O3S |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | ethyl (4S,5R,6S)-6-(3-cyanophenyl)-4-hydroxy-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(c2cccc(C#N)c2)NC(=S)N[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C15H14F3N3O3S/c1-2-24-12(22)10-11(9-5-3-4-8(6-9)7-19)20-13(25)21-14(10,23)15(16,17)18/h3-6,10-11,23H,2H2,1H3,(H2,20,21,25)/t10-,11?,14-/m0/s1 |
| InChIKey | UPUGJZNUONSAAN-PEMBBPQUSA-N |
| XLogP | 1.51 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|