About (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate
(3-methylimidazo[4,5-b]pyridin-6-yl) benzoate (PubChem CID 53322367) has the molecular formula C14H11N3O2
and a molecular weight of 253.26 g/mol. Its IUPAC name is (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate.
Molecular Properties
| Compound Name | (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate |
| PubChem CID | 53322367 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate |
| SMILES | Cn1cnc2cc(OC(=O)c3ccccc3)cnc21 |
| InChI | InChI=1S/C14H11N3O2/c1-17-9-16-12-7-11(8-15-13(12)17)19-14(18)10-5-3-2-4-6-10/h2-9H,1H3 |
| InChIKey | KAEOHXDNBGUDHW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate?
The IUPAC name of (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate (CID 53322367) is (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate.
What is the SMILES notation for (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate?
The canonical SMILES for (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate is Cn1cnc2cc(OC(=O)c3ccccc3)cnc21.
What is the InChIKey of (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate?
The InChIKey is KAEOHXDNBGUDHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2/c1-17-9-16-12-7-11(8-15-13(12)17)19-14(18)10-5-3-2-4-6-10/h2-9H,1H3.
What are the key properties of (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate?
(3-methylimidazo[4,5-b]pyridin-6-yl) benzoate has a molecular weight of 253.26 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylimidazo[4,5-b]pyridin-6-yl) benzoate is sourced from PubChem (CID 53322367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).