About 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate
4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate (PubChem CID 53322433) has the molecular formula C18H14F3NO4S2
and a molecular weight of 429.44 g/mol. Its IUPAC name is 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate |
| PubChem CID | 53322433 |
| Molecular Formula | C18H14F3NO4S2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate |
| SMILES | COc1cccc2cc3sc4ccccc4c3[n+](C)c12.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C17H14NOS.CHF3O3S/c1-18-16-11(6-5-8-13(16)19-2)10-15-17(18)12-7-3-4-9-14(12)20-15;2-1(3,4)8(5,6)7/h3-10H,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | MDCBTSXZYMTWDD-UHFFFAOYSA-M |
| XLogP | 4.09 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate?
The IUPAC name of 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate (CID 53322433) is 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate.
What is the SMILES notation for 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate?
The canonical SMILES for 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate is COc1cccc2cc3sc4ccccc4c3[n+](C)c12.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate?
The InChIKey is MDCBTSXZYMTWDD-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H14NOS.CHF3O3S/c1-18-16-11(6-5-8-13(16)19-2)10-15-17(18)12-7-3-4-9-14(12)20-15;2-1(3,4)8(5,6)7/h3-10H,1-2H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate?
4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate has a molecular weight of 429.44 g/mol, XLogP of 4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonate is sourced from PubChem (CID 53322433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).