About 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine
1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine (PubChem CID 53322451) has the molecular formula C16H23Cl2N
and a molecular weight of 300.27 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine |
| PubChem CID | 53322451 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine |
| SMILES | CC(N(C)C)C1(c2ccc(Cl)c(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C16H23Cl2N/c1-12(19(2)3)16(9-5-4-6-10-16)13-7-8-14(17)15(18)11-13/h7-8,11-12H,4-6,9-10H2,1-3H3 |
| InChIKey | OBWKCACUZGJXHN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine?
The IUPAC name of 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine (CID 53322451) is 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine.
What is the SMILES notation for 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine?
The canonical SMILES for 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine is CC(N(C)C)C1(c2ccc(Cl)c(Cl)c2)CCCCC1.
What is the InChIKey of 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine?
The InChIKey is OBWKCACUZGJXHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl2N/c1-12(19(2)3)16(9-5-4-6-10-16)13-7-8-14(17)15(18)11-13/h7-8,11-12H,4-6,9-10H2,1-3H3.
What are the key properties of 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine?
1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine has a molecular weight of 300.27 g/mol, XLogP of 5.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N,N-dimethylethanamine is sourced from PubChem (CID 53322451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).