C26H15F4NO4 — CID 53322454
10'-(dimethylamino)-4,5,6,7-tetrafluoro-3'-hydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one (PubChem CID 53322454) has the molecular formula C26H15F4NO4 and a molecular weight of 481.40 g/mol. Its IUPAC name is 10'-(dimethylamino)-4,5,6,7-tetrafluoro-3'-hydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one.
| Compound Name | 10'-(dimethylamino)-4,5,6,7-tetrafluoro-3'-hydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one |
|---|---|
| PubChem CID | 53322454 |
| Molecular Formula | C26H15F4NO4 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 10'-(dimethylamino)-4,5,6,7-tetrafluoro-3'-hydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one |
| SMILES | CN(C)c1ccc2c(c1)Oc1c(ccc3cc(O)ccc13)C21OC(=O)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C26H15F4NO4/c1-31(2)12-4-8-15-17(10-12)34-24-14-6-5-13(32)9-11(14)3-7-16(24)26(15)19-18(25(33)35-26)20(27)22(29)23(30)21(19)28/h3-10,32H,1-2H3 |
| InChIKey | LKABYIUBLPGRDH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|