C10H13F2NaO14P2 — CID 53322470
sodium (3R,4S,5R)-5-[(1S)-1-carboxy-2,2-difluoro-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate (PubChem CID 53322470) has the molecular formula C10H13F2NaO14P2 and a molecular weight of 480.13 g/mol. Its IUPAC name is sodium (3R,4S,5R)-5-[(1S)-1-carboxy-2,2-difluoro-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate.
| Compound Name | sodium (3R,4S,5R)-5-[(1S)-1-carboxy-2,2-difluoro-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 53322470 |
| Molecular Formula | C10H13F2NaO14P2 |
| Molecular Weight | 480.13 g/mol |
| Exact Mass | 479.96 |
| IUPAC Name | sodium (3R,4S,5R)-5-[(1S)-1-carboxy-2,2-difluoro-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate |
| SMILES | O=C([O-])C1=C[C@@H](OP(=O)(O)O)[C@@H](O)[C@H](O[C@](OP(=O)(O)O)(C(=O)O)C(F)F)C1.[Na+] |
| InChI | InChI=1S/C10H14F2O14P2.Na/c11-8(12)10(9(16)17,26-28(21,22)23)24-4-1-3(7(14)15)2-5(6(4)13)25-27(18,19)20;/h2,4-6,8,13H,1H2,(H,14,15)(H,16,17)(H2,18,19,20)(H2,21,22,23);/q;+1/p-1/t4-,5-,6+,10-;/m1./s1 |
| InChIKey | PHSVUZRDRYORKA-QIMFZATRSA-M |
| XLogP | -5.55 |
| TPSA | 240.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.13 |
| LogP ≤ 5 | -5.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|