C26H29N4O8PS — CID 53322559
ethyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 53322559) has the molecular formula C26H29N4O8PS and a molecular weight of 588.58 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 53322559 |
| Molecular Formula | C26H29N4O8PS |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc3c(-c4cccs4)ncnc32)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C26H29N4O8PS/c1-3-35-26(33)16(2)29-39(34,38-17-8-5-4-6-9-17)36-14-19-22(31)23(32)25(37-19)30-12-11-18-21(20-10-7-13-40-20)27-15-28-24(18)30/h4-13,15-16,19,22-23,25,31-32H,3,14H2,1-2H3,(H,29,34)/t16-,19+,22+,23+,25+,39?/m0/s1 |
| InChIKey | VDAQNWUBPMRFAZ-RHVCYYMLSA-N |
| XLogP | 3.52 |
| TPSA | 154.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|