About 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine
4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine (PubChem CID 53322823) has the molecular formula C23H30F2N2
and a molecular weight of 372.50 g/mol. Its IUPAC name is 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine |
| PubChem CID | 53322823 |
| Molecular Formula | C23H30F2N2 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine |
| SMILES | CCN(Cc1ccccc1)C1CCC([C@H](N)Cc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C23H30F2N2/c1-2-27(16-17-6-4-3-5-7-17)21-11-8-18(9-12-21)23(26)15-19-14-20(24)10-13-22(19)25/h3-7,10,13-14,18,21,23H,2,8-9,11-12,15-16,26H2,1H3/t18?,21?,23-/m1/s1 |
| InChIKey | QUWKQLILDNQOAB-PSGUAHCZSA-N |
| XLogP | 4.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine?
The IUPAC name of 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine (CID 53322823) is 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine.
What is the SMILES notation for 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine?
The canonical SMILES for 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine is CCN(Cc1ccccc1)C1CCC([C@H](N)Cc2cc(F)ccc2F)CC1.
What is the InChIKey of 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine?
The InChIKey is QUWKQLILDNQOAB-PSGUAHCZSA-N. The full InChI is InChI=1S/C23H30F2N2/c1-2-27(16-17-6-4-3-5-7-17)21-11-8-18(9-12-21)23(26)15-19-14-20(24)10-13-22(19)25/h3-7,10,13-14,18,21,23H,2,8-9,11-12,15-16,26H2,1H3/t18?,21?,23-/m1/s1.
What are the key properties of 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine?
4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine has a molecular weight of 372.50 g/mol, XLogP of 4.92, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]-N-benzyl-N-ethylcyclohexan-1-amine is sourced from PubChem (CID 53322823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).