About 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid
4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid (PubChem CID 53322868) has the molecular formula C26H22N2O3
and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid |
| PubChem CID | 53322868 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(CN2CCc3ccccc3C2c2ccccc2)c2ccccn2c1=O |
| InChI | InChI=1S/C26H22N2O3/c29-25-22(26(30)31)16-20(23-12-6-7-14-28(23)25)17-27-15-13-18-8-4-5-11-21(18)24(27)19-9-2-1-3-10-19/h1-12,14,16,24H,13,15,17H2,(H,30,31) |
| InChIKey | FKGRSMZFPMYWLA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid?
The IUPAC name of 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid (CID 53322868) is 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid.
What is the SMILES notation for 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid?
The canonical SMILES for 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid is O=C(O)c1cc(CN2CCc3ccccc3C2c2ccccc2)c2ccccn2c1=O.
What is the InChIKey of 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid?
The InChIKey is FKGRSMZFPMYWLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O3/c29-25-22(26(30)31)16-20(23-12-6-7-14-28(23)25)17-27-15-13-18-8-4-5-11-21(18)24(27)19-9-2-1-3-10-19/h1-12,14,16,24H,13,15,17H2,(H,30,31).
What are the key properties of 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid?
4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid has a molecular weight of 410.47 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-1-[(1-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]quinolizine-3-carboxylic acid is sourced from PubChem (CID 53322868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).