C33H26F4N4O4S — CID 53322906
benzyl N-[(2S)-1-[4-[2-(3-fluorophenyl)imino-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-5-yl]anilino]-1-oxopropan-2-yl]carbamate (PubChem CID 53322906) has the molecular formula C33H26F4N4O4S and a molecular weight of 650.65 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[4-[2-(3-fluorophenyl)imino-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-5-yl]anilino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[4-[2-(3-fluorophenyl)imino-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-5-yl]anilino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 53322906 |
| Molecular Formula | C33H26F4N4O4S |
| Molecular Weight | 650.65 g/mol |
| Exact Mass | 650.16 |
| IUPAC Name | benzyl N-[(2S)-1-[4-[2-(3-fluorophenyl)imino-4-oxo-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-5-yl]anilino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1ccc(C2S/C(=N\c3cccc(F)c3)N(Cc3ccc(F)c(F)c3F)C2=O)cc1 |
| InChI | InChI=1S/C33H26F4N4O4S/c1-19(38-33(44)45-18-20-6-3-2-4-7-20)30(42)39-24-13-10-21(11-14-24)29-31(43)41(17-22-12-15-26(35)28(37)27(22)36)32(46-29)40-25-9-5-8-23(34)16-25/h2-16,19,29H,17-18H2,1H3,(H,38,44)(H,39,42)/b40-32-/t19-,29?/m0/s1 |
| InChIKey | VJRHIMINOJMJPN-KFMMHFGISA-N |
| XLogP | 7.00 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|