About N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide
N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide (PubChem CID 53322967) has the molecular formula C21H17NO4S
and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide.
Molecular Properties
| Compound Name | N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide |
| PubChem CID | 53322967 |
| Molecular Formula | C21H17NO4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(C(=O)/C=C/c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C21H17NO4S/c23-18(9-3-14-4-10-19(24)20(25)12-14)15-5-7-16(8-6-15)22-21(26)13-17-2-1-11-27-17/h1-12,24-25H,13H2,(H,22,26)/b9-3+ |
| InChIKey | INKFSMLCYNADPG-YCRREMRBSA-N |
| XLogP | 4.24 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide?
The IUPAC name of N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide (CID 53322967) is N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide.
What is the SMILES notation for N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide?
The canonical SMILES for N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide is O=C(Cc1cccs1)Nc1ccc(C(=O)/C=C/c2ccc(O)c(O)c2)cc1.
What is the InChIKey of N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide?
The InChIKey is INKFSMLCYNADPG-YCRREMRBSA-N. The full InChI is InChI=1S/C21H17NO4S/c23-18(9-3-14-4-10-19(24)20(25)12-14)15-5-7-16(8-6-15)22-21(26)13-17-2-1-11-27-17/h1-12,24-25H,13H2,(H,22,26)/b9-3+.
What are the key properties of N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide?
N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide has a molecular weight of 379.44 g/mol, XLogP of 4.24, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-2-thiophen-2-ylacetamide is sourced from PubChem (CID 53322967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).