C14H19N2NaO7S — CID 53323064
sodium (2S,5R,6R)-6-[(1R)-1-hydroxy-2-oxo-2-pyrrolidin-1-ylethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 53323064) has the molecular formula C14H19N2NaO7S and a molecular weight of 382.37 g/mol. Its IUPAC name is sodium (2S,5R,6R)-6-[(1R)-1-hydroxy-2-oxo-2-pyrrolidin-1-ylethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-6-[(1R)-1-hydroxy-2-oxo-2-pyrrolidin-1-ylethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 53323064 |
| Molecular Formula | C14H19N2NaO7S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | sodium (2S,5R,6R)-6-[(1R)-1-hydroxy-2-oxo-2-pyrrolidin-1-ylethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)[C@@H]([C@@H](O)C(=O)N3CCCC3)[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C14H20N2O7S.Na/c1-14(2)9(13(20)21)16-10(18)7(12(16)24(14,22)23)8(17)11(19)15-5-3-4-6-15;/h7-9,12,17H,3-6H2,1-2H3,(H,20,21);/q;+1/p-1/t7-,8-,9+,12-;/m1./s1 |
| InChIKey | XORTYTOHXGCONF-GHRKWLBTSA-M |
| XLogP | -5.92 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |