C9H12NNaO6S — CID 53323066
sodium (2S,5R,6R)-6-(hydroxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 53323066) has the molecular formula C9H12NNaO6S and a molecular weight of 285.25 g/mol. Its IUPAC name is sodium (2S,5R,6R)-6-(hydroxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6R)-6-(hydroxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 53323066 |
| Molecular Formula | C9H12NNaO6S |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | sodium (2S,5R,6R)-6-(hydroxymethyl)-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)[C@@H](CO)[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C9H13NO6S.Na/c1-9(2)5(8(13)14)10-6(12)4(3-11)7(10)17(9,15)16;/h4-5,7,11H,3H2,1-2H3,(H,13,14);/q;+1/p-1/t4-,5+,7-;/m1./s1 |
| InChIKey | OQKSDOQLSKENEH-PKLNKYFDSA-M |
| XLogP | -5.91 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | -5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |