About (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate
(4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate (PubChem CID 53323352) has the molecular formula C26H22ClNO5
and a molecular weight of 463.92 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate |
| PubChem CID | 53323352 |
| Molecular Formula | C26H22ClNO5 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate |
| SMILES | COc1cc2c(=O)c(C(=O)OCc3ccc(Cl)cc3)cn(Cc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C26H22ClNO5/c1-31-23-12-20-22(13-24(23)32-2)28(14-17-6-4-3-5-7-17)15-21(25(20)29)26(30)33-16-18-8-10-19(27)11-9-18/h3-13,15H,14,16H2,1-2H3 |
| InChIKey | QXSTUOSTCGXPNX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate?
The IUPAC name of (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate (CID 53323352) is (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate.
What is the SMILES notation for (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate?
The canonical SMILES for (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate is COc1cc2c(=O)c(C(=O)OCc3ccc(Cl)cc3)cn(Cc3ccccc3)c2cc1OC.
What is the InChIKey of (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate?
The InChIKey is QXSTUOSTCGXPNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22ClNO5/c1-31-23-12-20-22(13-24(23)32-2)28(14-17-6-4-3-5-7-17)15-21(25(20)29)26(30)33-16-18-8-10-19(27)11-9-18/h3-13,15H,14,16H2,1-2H3.
What are the key properties of (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate?
(4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate has a molecular weight of 463.92 g/mol, XLogP of 5.08, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 1-benzyl-6,7-dimethoxy-4-oxoquinoline-3-carboxylate is sourced from PubChem (CID 53323352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).