C26H38N10O7 — CID 53323445
3-[3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(2H-tetrazole-5-carbonylamino)propanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]propanoylamino]benzoic acid (PubChem CID 53323445) has the molecular formula C26H38N10O7 and a molecular weight of 602.65 g/mol. Its IUPAC name is 3-[3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(2H-tetrazole-5-carbonylamino)propanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]propanoylamino]benzoic acid.
| Compound Name | 3-[3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(2H-tetrazole-5-carbonylamino)propanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 53323445 |
| Molecular Formula | C26H38N10O7 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | 3-[3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(2H-tetrazole-5-carbonylamino)propanoyl]amino]-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]propanoylamino]benzoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CNC(=O)c1nn[nH]n1)C(C)C)C(=O)NCCC(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C26H38N10O7/c1-13(2)10-18(23(39)28-9-8-19(37)30-16-7-5-6-15(11-16)26(42)43)31-24(40)20(14(3)4)32-22(38)17(27)12-29-25(41)21-33-35-36-34-21/h5-7,11,13-14,17-18,20H,8-10,12,27H2,1-4H3,(H,28,39)(H,29,41)(H,30,37)(H,31,40)(H,32,38)(H,42,43)(H,33,34,35,36)/t17-,18-,20-/m0/s1 |
| InChIKey | QNANLGAIPGCPBW-BJLQDIEVSA-N |
| XLogP | -1.23 |
| TPSA | 263.28 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |