C21H29N3O3 — CID 53323630
1-(3,5-dimethoxyphenyl)-4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]triazole (PubChem CID 53323630) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]triazole.
| Compound Name | 1-(3,5-dimethoxyphenyl)-4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]triazole |
|---|---|
| PubChem CID | 53323630 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]triazole |
| SMILES | COc1cc(OC)cc(-n2cc(COC/C=C(\C)CCC=C(C)C)nn2)c1 |
| InChI | InChI=1S/C21H29N3O3/c1-16(2)7-6-8-17(3)9-10-27-15-18-14-24(23-22-18)19-11-20(25-4)13-21(12-19)26-5/h7,9,11-14H,6,8,10,15H2,1-5H3/b17-9+ |
| InChIKey | PQIZORVTRHXHMM-RQZCQDPDSA-N |
| XLogP | 4.49 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|