C26H32N2O4 — CID 53323710
1-[(2E)-2-hydroxyimino-3-(4-octylphenoxy)propyl]indole-5-carboxylic acid (PubChem CID 53323710) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 1-[(2E)-2-hydroxyimino-3-(4-octylphenoxy)propyl]indole-5-carboxylic acid.
| Compound Name | 1-[(2E)-2-hydroxyimino-3-(4-octylphenoxy)propyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 53323710 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 1-[(2E)-2-hydroxyimino-3-(4-octylphenoxy)propyl]indole-5-carboxylic acid |
| SMILES | CCCCCCCCc1ccc(OC/C(Cn2ccc3cc(C(=O)O)ccc32)=N/O)cc1 |
| InChI | InChI=1S/C26H32N2O4/c1-2-3-4-5-6-7-8-20-9-12-24(13-10-20)32-19-23(27-31)18-28-16-15-21-17-22(26(29)30)11-14-25(21)28/h9-17,31H,2-8,18-19H2,1H3,(H,29,30)/b27-23+ |
| InChIKey | RLXZDZQLYPAAMB-SLEBQGDGSA-N |
| XLogP | 6.15 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|