About 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one
7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one (PubChem CID 53323739) has the molecular formula C15H13NO3
and a molecular weight of 255.27 g/mol. Its IUPAC name is 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one.
Molecular Properties
| Compound Name | 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one |
| PubChem CID | 53323739 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one |
| SMILES | O=C1CCOc2nc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C15H13NO3/c17-13-8-9-18-15-12(13)6-7-14(16-15)19-10-11-4-2-1-3-5-11/h1-7H,8-10H2 |
| InChIKey | FEUUEDWGFHWSKC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one?
The IUPAC name of 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one (CID 53323739) is 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one.
What is the SMILES notation for 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one?
The canonical SMILES for 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one is O=C1CCOc2nc(OCc3ccccc3)ccc21.
What is the InChIKey of 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one?
The InChIKey is FEUUEDWGFHWSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c17-13-8-9-18-15-12(13)6-7-14(16-15)19-10-11-4-2-1-3-5-11/h1-7H,8-10H2.
What are the key properties of 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one?
7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one has a molecular weight of 255.27 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenylmethoxy-2,3-dihydropyrano[2,3-b]pyridin-4-one is sourced from PubChem (CID 53323739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).