C33H47F5O4 — CID 53323790
10-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid (PubChem CID 53323790) has the molecular formula C33H47F5O4 and a molecular weight of 602.73 g/mol. Its IUPAC name is 10-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid.
| Compound Name | 10-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid |
|---|---|
| PubChem CID | 53323790 |
| Molecular Formula | C33H47F5O4 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | 10-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4C[C@@H](CCCCCCCCC(CCCC(F)(F)C(F)(F)F)C(=O)O)[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C33H47F5O4/c1-31-18-16-26-25-13-12-24(39)20-23(25)19-22(29(26)27(31)14-15-28(31)40)10-7-5-3-2-4-6-9-21(30(41)42)11-8-17-32(34,35)33(36,37)38/h12-13,20-22,26-29,39-40H,2-11,14-19H2,1H3,(H,41,42)/t21?,22-,26-,27+,28+,29-,31+/m1/s1 |
| InChIKey | DNVRUIXYIAQHJP-JARZQHDPSA-N |
| XLogP | 9.02 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|