About tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate
tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate (PubChem CID 53323811) has the molecular formula C21H30F2N2O3
and a molecular weight of 396.48 g/mol. Its IUPAC name is tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate |
| PubChem CID | 53323811 |
| Molecular Formula | C21H30F2N2O3 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate |
| SMILES | CC(CNC(=O)Cc1cccc(F)c1F)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H30F2N2O3/c1-14(13-24-18(26)12-16-6-5-7-17(22)19(16)23)15-8-10-25(11-9-15)20(27)28-21(2,3)4/h5-7,14-15H,8-13H2,1-4H3,(H,24,26) |
| InChIKey | FKKKFCPBYMOULG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate (CID 53323811) is tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate is CC(CNC(=O)Cc1cccc(F)c1F)C1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate?
The InChIKey is FKKKFCPBYMOULG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30F2N2O3/c1-14(13-24-18(26)12-16-6-5-7-17(22)19(16)23)15-8-10-25(11-9-15)20(27)28-21(2,3)4/h5-7,14-15H,8-13H2,1-4H3,(H,24,26).
What are the key properties of tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate?
tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate has a molecular weight of 396.48 g/mol, XLogP of 3.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[1-[[2-(2,3-difluorophenyl)acetyl]amino]propan-2-yl]piperidine-1-carboxylate is sourced from PubChem (CID 53323811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).